C25H35FO3S — CID 10670491
2-butyl-2-[[(R)-[4-fluoro-2-[(4-methoxyphenyl)methyl]phenyl]sulfinyl]methyl]hexan-1-ol (PubChem CID 10670491) has the molecular formula C25H35FO3S and a molecular weight of 434.62 g/mol. Its IUPAC name is 2-butyl-2-[[(R)-[4-fluoro-2-[(4-methoxyphenyl)methyl]phenyl]sulfinyl]methyl]hexan-1-ol.
| Compound Name | 2-butyl-2-[[(R)-[4-fluoro-2-[(4-methoxyphenyl)methyl]phenyl]sulfinyl]methyl]hexan-1-ol |
|---|---|
| PubChem CID | 10670491 |
| Molecular Formula | C25H35FO3S |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 2-butyl-2-[[(R)-[4-fluoro-2-[(4-methoxyphenyl)methyl]phenyl]sulfinyl]methyl]hexan-1-ol |
| SMILES | CCCCC(CO)(CCCC)C[S@@](=O)c1ccc(F)cc1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C25H35FO3S/c1-4-6-14-25(18-27,15-7-5-2)19-30(28)24-13-10-22(26)17-21(24)16-20-8-11-23(29-3)12-9-20/h8-13,17,27H,4-7,14-16,18-19H2,1-3H3/t30-/m1/s1 |
| InChIKey | ZWOAMAWIOPPTKS-SSEXGKCCSA-N |
| XLogP | 5.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |