C12H9ClF4O2 — CID 106705573
1-(3-chloroprop-1-ynyl)-3-fluoro-5-(2,2,2-trifluoroethoxymethoxy)benzene (PubChem CID 106705573) has the molecular formula C12H9ClF4O2 and a molecular weight of 296.65 g/mol. Its IUPAC name is 1-(3-chloroprop-1-ynyl)-3-fluoro-5-(2,2,2-trifluoroethoxymethoxy)benzene.
| Compound Name | 1-(3-chloroprop-1-ynyl)-3-fluoro-5-(2,2,2-trifluoroethoxymethoxy)benzene |
|---|---|
| PubChem CID | 106705573 |
| Molecular Formula | C12H9ClF4O2 |
| Molecular Weight | 296.65 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 1-(3-chloroprop-1-ynyl)-3-fluoro-5-(2,2,2-trifluoroethoxymethoxy)benzene |
| SMILES | Fc1cc(C#CCCl)cc(OCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H9ClF4O2/c13-3-1-2-9-4-10(14)6-11(5-9)19-8-18-7-12(15,16)17/h4-6H,3,7-8H2 |
| InChIKey | TVCMEAJEDLSUAH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.65 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|