C12H14F3NO4 — CID 106705762
2,2,2-trifluoroethoxymethyl 3-(2-aminophenoxy)propanoate (PubChem CID 106705762) has the molecular formula C12H14F3NO4 and a molecular weight of 293.24 g/mol. Its IUPAC name is 2,2,2-trifluoroethoxymethyl 3-(2-aminophenoxy)propanoate.
| Compound Name | 2,2,2-trifluoroethoxymethyl 3-(2-aminophenoxy)propanoate |
|---|---|
| PubChem CID | 106705762 |
| Molecular Formula | C12H14F3NO4 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 2,2,2-trifluoroethoxymethyl 3-(2-aminophenoxy)propanoate |
| SMILES | Nc1ccccc1OCCC(=O)OCOCC(F)(F)F |
| InChI | InChI=1S/C12H14F3NO4/c13-12(14,15)7-18-8-20-11(17)5-6-19-10-4-2-1-3-9(10)16/h1-4H,5-8,16H2 |
| InChIKey | SSZWKISYQZYAHR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|