C24H36O7 — CID 10670579
[(2R,3R,4S,5R,7S)-2-[[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-7-acetyloxy-4-hydroxy-1,6-dioxaspiro[2.4]heptan-5-yl] acetate (PubChem CID 10670579) has the molecular formula C24H36O7 and a molecular weight of 436.55 g/mol. Its IUPAC name is [(2R,3R,4S,5R,7S)-2-[[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-7-acetyloxy-4-hydroxy-1,6-dioxaspiro[2.4]heptan-5-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,7S)-2-[[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-7-acetyloxy-4-hydroxy-1,6-dioxaspiro[2.4]heptan-5-yl] acetate |
|---|---|
| PubChem CID | 10670579 |
| Molecular Formula | C24H36O7 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | [(2R,3R,4S,5R,7S)-2-[[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-7-acetyloxy-4-hydroxy-1,6-dioxaspiro[2.4]heptan-5-yl] acetate |
| SMILES | CC(=O)O[C@H]1O[C@@H](OC(C)=O)[C@@]2(O[C@@H]2C[C@@]2(C)[C@H](C)CC[C@@]3(C)C(C)=CCC[C@H]23)[C@@H]1O |
| InChI | InChI=1S/C24H36O7/c1-13-8-7-9-17-22(13,5)11-10-14(2)23(17,6)12-18-24(31-18)19(27)20(28-15(3)25)30-21(24)29-16(4)26/h8,14,17-21,27H,7,9-12H2,1-6H3/t14-,17+,18-,19-,20+,21-,22+,23+,24+/m1/s1 |
| InChIKey | RVFCBWZSWQCSCW-QGSQKNFOSA-N |
| XLogP | 3.48 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|