C13H24F3NO2 — CID 106705998
2-methoxy-N-[[1-(2,2,2-trifluoroethoxymethyl)cyclohexyl]methyl]ethanamine (PubChem CID 106705998) has the molecular formula C13H24F3NO2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-methoxy-N-[[1-(2,2,2-trifluoroethoxymethyl)cyclohexyl]methyl]ethanamine.
| Compound Name | 2-methoxy-N-[[1-(2,2,2-trifluoroethoxymethyl)cyclohexyl]methyl]ethanamine |
|---|---|
| PubChem CID | 106705998 |
| Molecular Formula | C13H24F3NO2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 2-methoxy-N-[[1-(2,2,2-trifluoroethoxymethyl)cyclohexyl]methyl]ethanamine |
| SMILES | COCCNCC1(COCC(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C13H24F3NO2/c1-18-8-7-17-9-12(5-3-2-4-6-12)10-19-11-13(14,15)16/h17H,2-11H2,1H3 |
| InChIKey | SSCFSIQEDPTDLM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|