C11H20F3NO — CID 106706234
2-methyl-N-propyl-2-(2,2,2-trifluoroethoxymethyl)but-3-en-1-amine (PubChem CID 106706234) has the molecular formula C11H20F3NO and a molecular weight of 239.28 g/mol. Its IUPAC name is 2-methyl-N-propyl-2-(2,2,2-trifluoroethoxymethyl)but-3-en-1-amine.
| Compound Name | 2-methyl-N-propyl-2-(2,2,2-trifluoroethoxymethyl)but-3-en-1-amine |
|---|---|
| PubChem CID | 106706234 |
| Molecular Formula | C11H20F3NO |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 2-methyl-N-propyl-2-(2,2,2-trifluoroethoxymethyl)but-3-en-1-amine |
| SMILES | C=CC(C)(CNCCC)COCC(F)(F)F |
| InChI | InChI=1S/C11H20F3NO/c1-4-6-15-7-10(3,5-2)8-16-9-11(12,13)14/h5,15H,2,4,6-9H2,1,3H3 |
| InChIKey | LPWQKJBFDWJNNF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|