C9H14BrF3O3S — CID 106706551
3-[1-bromo-3-(2,2,2-trifluoroethoxy)propan-2-yl]thiolane 1,1-dioxide (PubChem CID 106706551) has the molecular formula C9H14BrF3O3S and a molecular weight of 339.17 g/mol. Its IUPAC name is 3-[1-bromo-3-(2,2,2-trifluoroethoxy)propan-2-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[1-bromo-3-(2,2,2-trifluoroethoxy)propan-2-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 106706551 |
| Molecular Formula | C9H14BrF3O3S |
| Molecular Weight | 339.17 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | 3-[1-bromo-3-(2,2,2-trifluoroethoxy)propan-2-yl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(C(CBr)COCC(F)(F)F)C1 |
| InChI | InChI=1S/C9H14BrF3O3S/c10-3-8(4-16-6-9(11,12)13)7-1-2-17(14,15)5-7/h7-8H,1-6H2 |
| InChIKey | KLZOWHXJGGVACE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.17 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|