C10H15Br2F3O3S — CID 106706646
3-[1-bromo-2-(bromomethyl)-3-(2,2,2-trifluoroethoxy)propan-2-yl]thiolane 1,1-dioxide (PubChem CID 106706646) has the molecular formula C10H15Br2F3O3S and a molecular weight of 432.10 g/mol. Its IUPAC name is 3-[1-bromo-2-(bromomethyl)-3-(2,2,2-trifluoroethoxy)propan-2-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[1-bromo-2-(bromomethyl)-3-(2,2,2-trifluoroethoxy)propan-2-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 106706646 |
| Molecular Formula | C10H15Br2F3O3S |
| Molecular Weight | 432.10 g/mol |
| Exact Mass | 429.91 |
| IUPAC Name | 3-[1-bromo-2-(bromomethyl)-3-(2,2,2-trifluoroethoxy)propan-2-yl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(C(CBr)(CBr)COCC(F)(F)F)C1 |
| InChI | InChI=1S/C10H15Br2F3O3S/c11-4-9(5-12,6-18-7-10(13,14)15)8-1-2-19(16,17)3-8/h8H,1-7H2 |
| InChIKey | HBQQKCCVMYZMCU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.10 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|