C10H19NO3 — CID 106706987
tert-butyl 4-(dimethylamino)-4-oxobutanoate (PubChem CID 106706987) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is tert-butyl 4-(dimethylamino)-4-oxobutanoate.
| Compound Name | tert-butyl 4-(dimethylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 106706987 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | tert-butyl 4-(dimethylamino)-4-oxobutanoate |
| SMILES | CN(C)C(=O)CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H19NO3/c1-10(2,3)14-9(13)7-6-8(12)11(4)5/h6-7H2,1-5H3 |
| InChIKey | POKOKJCCDPKYEG-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |