About tert-butyl 4-[ethyl(2,2,2-trifluoroethyl)amino]-4-oxobutanoate
tert-butyl 4-[ethyl(2,2,2-trifluoroethyl)amino]-4-oxobutanoate (PubChem CID 106707273) has the molecular formula C12H20F3NO3
and a molecular weight of 283.29 g/mol. Its IUPAC name is tert-butyl 4-[ethyl(2,2,2-trifluoroethyl)amino]-4-oxobutanoate.
Molecular Properties
| Compound Name | tert-butyl 4-[ethyl(2,2,2-trifluoroethyl)amino]-4-oxobutanoate |
| PubChem CID | 106707273 |
| Molecular Formula | C12H20F3NO3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | tert-butyl 4-[ethyl(2,2,2-trifluoroethyl)amino]-4-oxobutanoate |
| SMILES | CCN(CC(F)(F)F)C(=O)CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H20F3NO3/c1-5-16(8-12(13,14)15)9(17)6-7-10(18)19-11(2,3)4/h5-8H2,1-4H3 |
| InChIKey | FMPPAUORNZDIHT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 4-[ethyl(2,2,2-trifluoroethyl)amino]-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[ethyl(2,2,2-trifluoroethyl)amino]-4-oxobutanoate?
The IUPAC name of tert-butyl 4-[ethyl(2,2,2-trifluoroethyl)amino]-4-oxobutanoate (CID 106707273) is tert-butyl 4-[ethyl(2,2,2-trifluoroethyl)amino]-4-oxobutanoate.
What is the SMILES notation for tert-butyl 4-[ethyl(2,2,2-trifluoroethyl)amino]-4-oxobutanoate?
The canonical SMILES for tert-butyl 4-[ethyl(2,2,2-trifluoroethyl)amino]-4-oxobutanoate is CCN(CC(F)(F)F)C(=O)CCC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 4-[ethyl(2,2,2-trifluoroethyl)amino]-4-oxobutanoate?
The InChIKey is FMPPAUORNZDIHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20F3NO3/c1-5-16(8-12(13,14)15)9(17)6-7-10(18)19-11(2,3)4/h5-8H2,1-4H3.
What are the key properties of tert-butyl 4-[ethyl(2,2,2-trifluoroethyl)amino]-4-oxobutanoate?
tert-butyl 4-[ethyl(2,2,2-trifluoroethyl)amino]-4-oxobutanoate has a molecular weight of 283.29 g/mol, XLogP of 2.52, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[ethyl(2,2,2-trifluoroethyl)amino]-4-oxobutanoate is sourced from PubChem (CID 106707273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).