C21H33NO5SSi — CID 10670738
(4S,5S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenyl-3-(2,4,6-trimethylphenyl)sulfonyl-1,3-oxazolidin-2-one (PubChem CID 10670738) has the molecular formula C21H33NO5SSi and a molecular weight of 439.65 g/mol. Its IUPAC name is (4S,5S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenyl-3-(2,4,6-trimethylphenyl)sulfonyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenyl-3-(2,4,6-trimethylphenyl)sulfonyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10670738 |
| Molecular Formula | C21H33NO5SSi |
| Molecular Weight | 439.65 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | (4S,5S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenyl-3-(2,4,6-trimethylphenyl)sulfonyl-1,3-oxazolidin-2-one |
| SMILES | C=C[C@@H]1OC(=O)N(S(=O)(=O)c2c(C)cc(C)cc2C)[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H33NO5SSi/c1-10-18-17(13-26-29(8,9)21(5,6)7)22(20(23)27-18)28(24,25)19-15(3)11-14(2)12-16(19)4/h10-12,17-18H,1,13H2,2-9H3/t17-,18-/m0/s1 |
| InChIKey | KOLJXDZEHQPZCD-ROUUACIJSA-N |
| XLogP | 4.70 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.65 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|