C16H28N2O — CID 106708049
N'-(3-methoxyphenyl)-N',2,2-trimethylhexane-1,6-diamine (PubChem CID 106708049) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is N'-(3-methoxyphenyl)-N',2,2-trimethylhexane-1,6-diamine.
| Compound Name | N'-(3-methoxyphenyl)-N',2,2-trimethylhexane-1,6-diamine |
|---|---|
| PubChem CID | 106708049 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | N'-(3-methoxyphenyl)-N',2,2-trimethylhexane-1,6-diamine |
| SMILES | COc1cccc(N(C)CCCCC(C)(C)CN)c1 |
| InChI | InChI=1S/C16H28N2O/c1-16(2,13-17)10-5-6-11-18(3)14-8-7-9-15(12-14)19-4/h7-9,12H,5-6,10-11,13,17H2,1-4H3 |
| InChIKey | IPAIBQXDXVNRBT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|