C13H30N2O — CID 106708171
1-[(6-amino-5,5-dimethylhexyl)-methylamino]-2-methylpropan-2-ol (PubChem CID 106708171) has the molecular formula C13H30N2O and a molecular weight of 230.40 g/mol. Its IUPAC name is 1-[(6-amino-5,5-dimethylhexyl)-methylamino]-2-methylpropan-2-ol.
| Compound Name | 1-[(6-amino-5,5-dimethylhexyl)-methylamino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 106708171 |
| Molecular Formula | C13H30N2O |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.24 |
| IUPAC Name | 1-[(6-amino-5,5-dimethylhexyl)-methylamino]-2-methylpropan-2-ol |
| SMILES | CN(CCCCC(C)(C)CN)CC(C)(C)O |
| InChI | InChI=1S/C13H30N2O/c1-12(2,10-14)8-6-7-9-15(5)11-13(3,4)16/h16H,6-11,14H2,1-5H3 |
| InChIKey | ADUWSLPDXUYADF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|