C12H21N3O3 — CID 106708357
1-(6-amino-5,5-dimethylhexyl)-3-methylimidazolidine-2,4,5-trione (PubChem CID 106708357) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is 1-(6-amino-5,5-dimethylhexyl)-3-methylimidazolidine-2,4,5-trione.
| Compound Name | 1-(6-amino-5,5-dimethylhexyl)-3-methylimidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 106708357 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 1-(6-amino-5,5-dimethylhexyl)-3-methylimidazolidine-2,4,5-trione |
| SMILES | CN1C(=O)C(=O)N(CCCCC(C)(C)CN)C1=O |
| InChI | InChI=1S/C12H21N3O3/c1-12(2,8-13)6-4-5-7-15-10(17)9(16)14(3)11(15)18/h4-8,13H2,1-3H3 |
| InChIKey | JNOSTJHITPCTDE-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|