C14H26N2O2 — CID 106708431
1-(6-amino-5,5-dimethylhexyl)-3,3-dimethylpyrrolidine-2,5-dione (PubChem CID 106708431) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is 1-(6-amino-5,5-dimethylhexyl)-3,3-dimethylpyrrolidine-2,5-dione.
| Compound Name | 1-(6-amino-5,5-dimethylhexyl)-3,3-dimethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 106708431 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | 1-(6-amino-5,5-dimethylhexyl)-3,3-dimethylpyrrolidine-2,5-dione |
| SMILES | CC(C)(CN)CCCCN1C(=O)CC(C)(C)C1=O |
| InChI | InChI=1S/C14H26N2O2/c1-13(2,10-15)7-5-6-8-16-11(17)9-14(3,4)12(16)18/h5-10,15H2,1-4H3 |
| InChIKey | ZWOVKLVZLHIJBF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|