About 1-(6-amino-5,5-dimethylhexyl)-3-propylimidazol-2-one
1-(6-amino-5,5-dimethylhexyl)-3-propylimidazol-2-one (PubChem CID 106708444) has the molecular formula C14H27N3O
and a molecular weight of 253.39 g/mol. Its IUPAC name is 1-(6-amino-5,5-dimethylhexyl)-3-propylimidazol-2-one.
Molecular Properties
| Compound Name | 1-(6-amino-5,5-dimethylhexyl)-3-propylimidazol-2-one |
| PubChem CID | 106708444 |
| Molecular Formula | C14H27N3O |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | 1-(6-amino-5,5-dimethylhexyl)-3-propylimidazol-2-one |
| SMILES | CCCn1ccn(CCCCC(C)(C)CN)c1=O |
| InChI | InChI=1S/C14H27N3O/c1-4-8-16-10-11-17(13(16)18)9-6-5-7-14(2,3)12-15/h10-11H,4-9,12,15H2,1-3H3 |
| InChIKey | YFSNZZDHUZKPGY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-amino-5,5-dimethylhexyl)-3-propylimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-amino-5,5-dimethylhexyl)-3-propylimidazol-2-one?
The IUPAC name of 1-(6-amino-5,5-dimethylhexyl)-3-propylimidazol-2-one (CID 106708444) is 1-(6-amino-5,5-dimethylhexyl)-3-propylimidazol-2-one.
What is the SMILES notation for 1-(6-amino-5,5-dimethylhexyl)-3-propylimidazol-2-one?
The canonical SMILES for 1-(6-amino-5,5-dimethylhexyl)-3-propylimidazol-2-one is CCCn1ccn(CCCCC(C)(C)CN)c1=O.
What is the InChIKey of 1-(6-amino-5,5-dimethylhexyl)-3-propylimidazol-2-one?
The InChIKey is YFSNZZDHUZKPGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N3O/c1-4-8-16-10-11-17(13(16)18)9-6-5-7-14(2,3)12-15/h10-11H,4-9,12,15H2,1-3H3.
What are the key properties of 1-(6-amino-5,5-dimethylhexyl)-3-propylimidazol-2-one?
1-(6-amino-5,5-dimethylhexyl)-3-propylimidazol-2-one has a molecular weight of 253.39 g/mol, XLogP of 2.21, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-amino-5,5-dimethylhexyl)-3-propylimidazol-2-one is sourced from PubChem (CID 106708444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).