About 1-(6-amino-5,5-dimethylhexyl)-6-(trifluoromethyl)pyridin-2-one
1-(6-amino-5,5-dimethylhexyl)-6-(trifluoromethyl)pyridin-2-one (PubChem CID 106708447) has the molecular formula C14H21F3N2O
and a molecular weight of 290.33 g/mol. Its IUPAC name is 1-(6-amino-5,5-dimethylhexyl)-6-(trifluoromethyl)pyridin-2-one.
Molecular Properties
| Compound Name | 1-(6-amino-5,5-dimethylhexyl)-6-(trifluoromethyl)pyridin-2-one |
| PubChem CID | 106708447 |
| Molecular Formula | C14H21F3N2O |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 1-(6-amino-5,5-dimethylhexyl)-6-(trifluoromethyl)pyridin-2-one |
| SMILES | CC(C)(CN)CCCCn1c(C(F)(F)F)cccc1=O |
| InChI | InChI=1S/C14H21F3N2O/c1-13(2,10-18)8-3-4-9-19-11(14(15,16)17)6-5-7-12(19)20/h5-7H,3-4,8-10,18H2,1-2H3 |
| InChIKey | RPUYPFMBHWCHDT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-amino-5,5-dimethylhexyl)-6-(trifluoromethyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-amino-5,5-dimethylhexyl)-6-(trifluoromethyl)pyridin-2-one?
The IUPAC name of 1-(6-amino-5,5-dimethylhexyl)-6-(trifluoromethyl)pyridin-2-one (CID 106708447) is 1-(6-amino-5,5-dimethylhexyl)-6-(trifluoromethyl)pyridin-2-one.
What is the SMILES notation for 1-(6-amino-5,5-dimethylhexyl)-6-(trifluoromethyl)pyridin-2-one?
The canonical SMILES for 1-(6-amino-5,5-dimethylhexyl)-6-(trifluoromethyl)pyridin-2-one is CC(C)(CN)CCCCn1c(C(F)(F)F)cccc1=O.
What is the InChIKey of 1-(6-amino-5,5-dimethylhexyl)-6-(trifluoromethyl)pyridin-2-one?
The InChIKey is RPUYPFMBHWCHDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21F3N2O/c1-13(2,10-18)8-3-4-9-19-11(14(15,16)17)6-5-7-12(19)20/h5-7H,3-4,8-10,18H2,1-2H3.
What are the key properties of 1-(6-amino-5,5-dimethylhexyl)-6-(trifluoromethyl)pyridin-2-one?
1-(6-amino-5,5-dimethylhexyl)-6-(trifluoromethyl)pyridin-2-one has a molecular weight of 290.33 g/mol, XLogP of 3.02, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-amino-5,5-dimethylhexyl)-6-(trifluoromethyl)pyridin-2-one is sourced from PubChem (CID 106708447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).