C16H30N4O — CID 106708470
2-(6-amino-5,5-dimethylhexyl)-5-[methyl(propyl)amino]pyridazin-3-one (PubChem CID 106708470) has the molecular formula C16H30N4O and a molecular weight of 294.44 g/mol. Its IUPAC name is 2-(6-amino-5,5-dimethylhexyl)-5-[methyl(propyl)amino]pyridazin-3-one.
| Compound Name | 2-(6-amino-5,5-dimethylhexyl)-5-[methyl(propyl)amino]pyridazin-3-one |
|---|---|
| PubChem CID | 106708470 |
| Molecular Formula | C16H30N4O |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | 2-(6-amino-5,5-dimethylhexyl)-5-[methyl(propyl)amino]pyridazin-3-one |
| SMILES | CCCN(C)c1cnn(CCCCC(C)(C)CN)c(=O)c1 |
| InChI | InChI=1S/C16H30N4O/c1-5-9-19(4)14-11-15(21)20(18-12-14)10-7-6-8-16(2,3)13-17/h11-12H,5-10,13,17H2,1-4H3 |
| InChIKey | RAQMJJBLUJUFRX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|