About 2-(6-amino-5,5-dimethylhexyl)-5-methylpyridazin-3-one
2-(6-amino-5,5-dimethylhexyl)-5-methylpyridazin-3-one (PubChem CID 106708476) has the molecular formula C13H23N3O
and a molecular weight of 237.35 g/mol. Its IUPAC name is 2-(6-amino-5,5-dimethylhexyl)-5-methylpyridazin-3-one.
Molecular Properties
| Compound Name | 2-(6-amino-5,5-dimethylhexyl)-5-methylpyridazin-3-one |
| PubChem CID | 106708476 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 2-(6-amino-5,5-dimethylhexyl)-5-methylpyridazin-3-one |
| SMILES | Cc1cnn(CCCCC(C)(C)CN)c(=O)c1 |
| InChI | InChI=1S/C13H23N3O/c1-11-8-12(17)16(15-9-11)7-5-4-6-13(2,3)10-14/h8-9H,4-7,10,14H2,1-3H3 |
| InChIKey | DJJUBWXHTPGOEN-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-amino-5,5-dimethylhexyl)-5-methylpyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-amino-5,5-dimethylhexyl)-5-methylpyridazin-3-one?
The IUPAC name of 2-(6-amino-5,5-dimethylhexyl)-5-methylpyridazin-3-one (CID 106708476) is 2-(6-amino-5,5-dimethylhexyl)-5-methylpyridazin-3-one.
What is the SMILES notation for 2-(6-amino-5,5-dimethylhexyl)-5-methylpyridazin-3-one?
The canonical SMILES for 2-(6-amino-5,5-dimethylhexyl)-5-methylpyridazin-3-one is Cc1cnn(CCCCC(C)(C)CN)c(=O)c1.
What is the InChIKey of 2-(6-amino-5,5-dimethylhexyl)-5-methylpyridazin-3-one?
The InChIKey is DJJUBWXHTPGOEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O/c1-11-8-12(17)16(15-9-11)7-5-4-6-13(2,3)10-14/h8-9H,4-7,10,14H2,1-3H3.
What are the key properties of 2-(6-amino-5,5-dimethylhexyl)-5-methylpyridazin-3-one?
2-(6-amino-5,5-dimethylhexyl)-5-methylpyridazin-3-one has a molecular weight of 237.35 g/mol, XLogP of 1.71, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-amino-5,5-dimethylhexyl)-5-methylpyridazin-3-one is sourced from PubChem (CID 106708476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).