C18H28N2O — CID 106708794
2,2-dimethyl-6-[4-methyl-2-[1-(methylamino)ethyl]phenoxy]hexanenitrile (PubChem CID 106708794) has the molecular formula C18H28N2O and a molecular weight of 288.44 g/mol. Its IUPAC name is 2,2-dimethyl-6-[4-methyl-2-[1-(methylamino)ethyl]phenoxy]hexanenitrile.
| Compound Name | 2,2-dimethyl-6-[4-methyl-2-[1-(methylamino)ethyl]phenoxy]hexanenitrile |
|---|---|
| PubChem CID | 106708794 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 2,2-dimethyl-6-[4-methyl-2-[1-(methylamino)ethyl]phenoxy]hexanenitrile |
| SMILES | CNC(C)c1cc(C)ccc1OCCCCC(C)(C)C#N |
| InChI | InChI=1S/C18H28N2O/c1-14-8-9-17(16(12-14)15(2)20-5)21-11-7-6-10-18(3,4)13-19/h8-9,12,15,20H,6-7,10-11H2,1-5H3 |
| InChIKey | NQLXYEVOUQCMHL-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|