C12H21F3N2O — CID 106709334
2,2-dimethyl-6-[2-(2,2,2-trifluoroethoxy)ethylamino]hexanenitrile (PubChem CID 106709334) has the molecular formula C12H21F3N2O and a molecular weight of 266.31 g/mol. Its IUPAC name is 2,2-dimethyl-6-[2-(2,2,2-trifluoroethoxy)ethylamino]hexanenitrile.
| Compound Name | 2,2-dimethyl-6-[2-(2,2,2-trifluoroethoxy)ethylamino]hexanenitrile |
|---|---|
| PubChem CID | 106709334 |
| Molecular Formula | C12H21F3N2O |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 2,2-dimethyl-6-[2-(2,2,2-trifluoroethoxy)ethylamino]hexanenitrile |
| SMILES | CC(C)(C#N)CCCCNCCOCC(F)(F)F |
| InChI | InChI=1S/C12H21F3N2O/c1-11(2,9-16)5-3-4-6-17-7-8-18-10-12(13,14)15/h17H,3-8,10H2,1-2H3 |
| InChIKey | OHLDGBVHROJZCC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|