C15H20N4 — CID 106709701
6-(6-aminoindazol-1-yl)-2,2-dimethylhexanenitrile (PubChem CID 106709701) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is 6-(6-aminoindazol-1-yl)-2,2-dimethylhexanenitrile.
| Compound Name | 6-(6-aminoindazol-1-yl)-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106709701 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 6-(6-aminoindazol-1-yl)-2,2-dimethylhexanenitrile |
| SMILES | CC(C)(C#N)CCCCn1ncc2ccc(N)cc21 |
| InChI | InChI=1S/C15H20N4/c1-15(2,11-16)7-3-4-8-19-14-9-13(17)6-5-12(14)10-18-19/h5-6,9-10H,3-4,7-8,17H2,1-2H3 |
| InChIKey | RZJLGYRQNMNTCC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|