C22H44O5Si2 — CID 10670981
(E,4S,5R)-1,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(methoxymethoxy)oct-6-en-2-yn-4-ol (PubChem CID 10670981) has the molecular formula C22H44O5Si2 and a molecular weight of 444.76 g/mol. Its IUPAC name is (E,4S,5R)-1,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(methoxymethoxy)oct-6-en-2-yn-4-ol.
| Compound Name | (E,4S,5R)-1,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(methoxymethoxy)oct-6-en-2-yn-4-ol |
|---|---|
| PubChem CID | 10670981 |
| Molecular Formula | C22H44O5Si2 |
| Molecular Weight | 444.76 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | (E,4S,5R)-1,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(methoxymethoxy)oct-6-en-2-yn-4-ol |
| SMILES | COCO[C@H](/C=C/CO[Si](C)(C)C(C)(C)C)[C@@H](O)C#CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H44O5Si2/c1-21(2,3)28(8,9)26-16-12-14-19(23)20(25-18-24-7)15-13-17-27-29(10,11)22(4,5)6/h13,15,19-20,23H,16-18H2,1-11H3/b15-13+/t19-,20+/m0/s1 |
| InChIKey | NIIHIDUNMDCYNW-VIDFKJSCSA-N |
| XLogP | 4.94 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.76 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|