C11H16F5NO — CID 106710519
2,2-dimethyl-6-(2,2,3,3,3-pentafluoropropoxy)hexanenitrile (PubChem CID 106710519) has the molecular formula C11H16F5NO and a molecular weight of 273.24 g/mol. Its IUPAC name is 2,2-dimethyl-6-(2,2,3,3,3-pentafluoropropoxy)hexanenitrile.
| Compound Name | 2,2-dimethyl-6-(2,2,3,3,3-pentafluoropropoxy)hexanenitrile |
|---|---|
| PubChem CID | 106710519 |
| Molecular Formula | C11H16F5NO |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 2,2-dimethyl-6-(2,2,3,3,3-pentafluoropropoxy)hexanenitrile |
| SMILES | CC(C)(C#N)CCCCOCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H16F5NO/c1-9(2,7-17)5-3-4-6-18-8-10(12,13)11(14,15)16/h3-6,8H2,1-2H3 |
| InChIKey | YNKYLPBZGAFSPV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|