About 6-(4-ethylpiperazin-1-yl)-N'-hydroxy-2,2-dimethylhexanimidamide
6-(4-ethylpiperazin-1-yl)-N'-hydroxy-2,2-dimethylhexanimidamide (PubChem CID 106710707) has the molecular formula C14H30N4O
and a molecular weight of 270.42 g/mol. Its IUPAC name is 6-(4-ethylpiperazin-1-yl)-N'-hydroxy-2,2-dimethylhexanimidamide.
Molecular Properties
| Compound Name | 6-(4-ethylpiperazin-1-yl)-N'-hydroxy-2,2-dimethylhexanimidamide |
| PubChem CID | 106710707 |
| Molecular Formula | C14H30N4O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.24 |
| IUPAC Name | 6-(4-ethylpiperazin-1-yl)-N'-hydroxy-2,2-dimethylhexanimidamide |
| SMILES | CCN1CCN(CCCCC(C)(C)C(N)=NO)CC1 |
| InChI | InChI=1S/C14H30N4O/c1-4-17-9-11-18(12-10-17)8-6-5-7-14(2,3)13(15)16-19/h19H,4-12H2,1-3H3,(H2,15,16) |
| InChIKey | GTMRCLHENCYZDA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-ethylpiperazin-1-yl)-N'-hydroxy-2,2-dimethylhexanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-ethylpiperazin-1-yl)-N'-hydroxy-2,2-dimethylhexanimidamide?
The IUPAC name of 6-(4-ethylpiperazin-1-yl)-N'-hydroxy-2,2-dimethylhexanimidamide (CID 106710707) is 6-(4-ethylpiperazin-1-yl)-N'-hydroxy-2,2-dimethylhexanimidamide.
What is the SMILES notation for 6-(4-ethylpiperazin-1-yl)-N'-hydroxy-2,2-dimethylhexanimidamide?
The canonical SMILES for 6-(4-ethylpiperazin-1-yl)-N'-hydroxy-2,2-dimethylhexanimidamide is CCN1CCN(CCCCC(C)(C)C(N)=NO)CC1.
What is the InChIKey of 6-(4-ethylpiperazin-1-yl)-N'-hydroxy-2,2-dimethylhexanimidamide?
The InChIKey is GTMRCLHENCYZDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30N4O/c1-4-17-9-11-18(12-10-17)8-6-5-7-14(2,3)13(15)16-19/h19H,4-12H2,1-3H3,(H2,15,16).
What are the key properties of 6-(4-ethylpiperazin-1-yl)-N'-hydroxy-2,2-dimethylhexanimidamide?
6-(4-ethylpiperazin-1-yl)-N'-hydroxy-2,2-dimethylhexanimidamide has a molecular weight of 270.42 g/mol, XLogP of 1.57, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-ethylpiperazin-1-yl)-N'-hydroxy-2,2-dimethylhexanimidamide is sourced from PubChem (CID 106710707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).