C16H34N4O — CID 106710834
6-[(1-ethylpiperidin-4-yl)-methylamino]-N'-hydroxy-2,2-dimethylhexanimidamide (PubChem CID 106710834) has the molecular formula C16H34N4O and a molecular weight of 298.47 g/mol. Its IUPAC name is 6-[(1-ethylpiperidin-4-yl)-methylamino]-N'-hydroxy-2,2-dimethylhexanimidamide.
| Compound Name | 6-[(1-ethylpiperidin-4-yl)-methylamino]-N'-hydroxy-2,2-dimethylhexanimidamide |
|---|---|
| PubChem CID | 106710834 |
| Molecular Formula | C16H34N4O |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | 6-[(1-ethylpiperidin-4-yl)-methylamino]-N'-hydroxy-2,2-dimethylhexanimidamide |
| SMILES | CCN1CCC(N(C)CCCCC(C)(C)C(N)=NO)CC1 |
| InChI | InChI=1S/C16H34N4O/c1-5-20-12-8-14(9-13-20)19(4)11-7-6-10-16(2,3)15(17)18-21/h14,21H,5-13H2,1-4H3,(H2,17,18) |
| InChIKey | JOJJCFMMGSZIKI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|