C13H26N6O — CID 106711154
N'-hydroxy-2,2-dimethyl-6-[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]hexanimidamide (PubChem CID 106711154) has the molecular formula C13H26N6O and a molecular weight of 282.39 g/mol. Its IUPAC name is N'-hydroxy-2,2-dimethyl-6-[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]hexanimidamide.
| Compound Name | N'-hydroxy-2,2-dimethyl-6-[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]hexanimidamide |
|---|---|
| PubChem CID | 106711154 |
| Molecular Formula | C13H26N6O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | N'-hydroxy-2,2-dimethyl-6-[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]hexanimidamide |
| SMILES | Cn1cnnc1CCNCCCCC(C)(C)C(N)=NO |
| InChI | InChI=1S/C13H26N6O/c1-13(2,12(14)18-20)7-4-5-8-15-9-6-11-17-16-10-19(11)3/h10,15,20H,4-9H2,1-3H3,(H2,14,18) |
| InChIKey | HEIVCFRSWBNMDI-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 101.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|