C15H33N3O — CID 106711358
N'-hydroxy-2,2-dimethyl-6-(4-methylhexan-2-ylamino)hexanimidamide (PubChem CID 106711358) has the molecular formula C15H33N3O and a molecular weight of 271.45 g/mol. Its IUPAC name is N'-hydroxy-2,2-dimethyl-6-(4-methylhexan-2-ylamino)hexanimidamide.
| Compound Name | N'-hydroxy-2,2-dimethyl-6-(4-methylhexan-2-ylamino)hexanimidamide |
|---|---|
| PubChem CID | 106711358 |
| Molecular Formula | C15H33N3O |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.26 |
| IUPAC Name | N'-hydroxy-2,2-dimethyl-6-(4-methylhexan-2-ylamino)hexanimidamide |
| SMILES | CCC(C)CC(C)NCCCCC(C)(C)C(N)=NO |
| InChI | InChI=1S/C15H33N3O/c1-6-12(2)11-13(3)17-10-8-7-9-15(4,5)14(16)18-19/h12-13,17,19H,6-11H2,1-5H3,(H2,16,18) |
| InChIKey | CLOZKWHXXWPMES-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|