C12H24N6O — CID 106711569
N'-hydroxy-2,2-dimethyl-6-[2-(triazol-1-yl)ethylamino]hexanimidamide (PubChem CID 106711569) has the molecular formula C12H24N6O and a molecular weight of 268.36 g/mol. Its IUPAC name is N'-hydroxy-2,2-dimethyl-6-[2-(triazol-1-yl)ethylamino]hexanimidamide.
| Compound Name | N'-hydroxy-2,2-dimethyl-6-[2-(triazol-1-yl)ethylamino]hexanimidamide |
|---|---|
| PubChem CID | 106711569 |
| Molecular Formula | C12H24N6O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | N'-hydroxy-2,2-dimethyl-6-[2-(triazol-1-yl)ethylamino]hexanimidamide |
| SMILES | CC(C)(CCCCNCCn1ccnn1)/C(N)=N/O |
| InChI | InChI=1S/C12H24N6O/c1-12(2,11(13)16-19)5-3-4-6-14-7-9-18-10-8-15-17-18/h8,10,14,19H,3-7,9H2,1-2H3,(H2,13,16) |
| InChIKey | WEJPNGVZQSBLQZ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 101.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|