C15H31N3O2 — CID 106711666
N'-hydroxy-6-[(1-hydroxycyclopentyl)methyl-methylamino]-2,2-dimethylhexanimidamide (PubChem CID 106711666) has the molecular formula C15H31N3O2 and a molecular weight of 285.43 g/mol. Its IUPAC name is N'-hydroxy-6-[(1-hydroxycyclopentyl)methyl-methylamino]-2,2-dimethylhexanimidamide.
| Compound Name | N'-hydroxy-6-[(1-hydroxycyclopentyl)methyl-methylamino]-2,2-dimethylhexanimidamide |
|---|---|
| PubChem CID | 106711666 |
| Molecular Formula | C15H31N3O2 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.24 |
| IUPAC Name | N'-hydroxy-6-[(1-hydroxycyclopentyl)methyl-methylamino]-2,2-dimethylhexanimidamide |
| SMILES | CN(CCCCC(C)(C)C(N)=NO)CC1(O)CCCC1 |
| InChI | InChI=1S/C15H31N3O2/c1-14(2,13(16)17-20)8-6-7-11-18(3)12-15(19)9-4-5-10-15/h19-20H,4-12H2,1-3H3,(H2,16,17) |
| InChIKey | KUNNZIMUDIPCON-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|