About 6-[(5-bromo-3-pyridinyl)oxy]-N'-hydroxy-2,2-dimethylhexanimidamide
6-[(5-bromo-3-pyridinyl)oxy]-N'-hydroxy-2,2-dimethylhexanimidamide (PubChem CID 106711855) has the molecular formula C13H20BrN3O2
and a molecular weight of 330.23 g/mol. Its IUPAC name is 6-[(5-bromo-3-pyridinyl)oxy]-N'-hydroxy-2,2-dimethylhexanimidamide.
Molecular Properties
| Compound Name | 6-[(5-bromo-3-pyridinyl)oxy]-N'-hydroxy-2,2-dimethylhexanimidamide |
| PubChem CID | 106711855 |
| Molecular Formula | C13H20BrN3O2 |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 6-[(5-bromo-3-pyridinyl)oxy]-N'-hydroxy-2,2-dimethylhexanimidamide |
| SMILES | CC(C)(CCCCOc1cncc(Br)c1)/C(N)=N/O |
| InChI | InChI=1S/C13H20BrN3O2/c1-13(2,12(15)17-18)5-3-4-6-19-11-7-10(14)8-16-9-11/h7-9,18H,3-6H2,1-2H3,(H2,15,17) |
| InChIKey | PXUZNHBAFJZVMX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[(5-bromo-3-pyridinyl)oxy]-N'-hydroxy-2,2-dimethylhexanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(5-bromo-3-pyridinyl)oxy]-N'-hydroxy-2,2-dimethylhexanimidamide?
The IUPAC name of 6-[(5-bromo-3-pyridinyl)oxy]-N'-hydroxy-2,2-dimethylhexanimidamide (CID 106711855) is 6-[(5-bromo-3-pyridinyl)oxy]-N'-hydroxy-2,2-dimethylhexanimidamide.
What is the SMILES notation for 6-[(5-bromo-3-pyridinyl)oxy]-N'-hydroxy-2,2-dimethylhexanimidamide?
The canonical SMILES for 6-[(5-bromo-3-pyridinyl)oxy]-N'-hydroxy-2,2-dimethylhexanimidamide is CC(C)(CCCCOc1cncc(Br)c1)/C(N)=N/O.
What is the InChIKey of 6-[(5-bromo-3-pyridinyl)oxy]-N'-hydroxy-2,2-dimethylhexanimidamide?
The InChIKey is PXUZNHBAFJZVMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20BrN3O2/c1-13(2,12(15)17-18)5-3-4-6-19-11-7-10(14)8-16-9-11/h7-9,18H,3-6H2,1-2H3,(H2,15,17).
What are the key properties of 6-[(5-bromo-3-pyridinyl)oxy]-N'-hydroxy-2,2-dimethylhexanimidamide?
6-[(5-bromo-3-pyridinyl)oxy]-N'-hydroxy-2,2-dimethylhexanimidamide has a molecular weight of 330.23 g/mol, XLogP of 3.17, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(5-bromo-3-pyridinyl)oxy]-N'-hydroxy-2,2-dimethylhexanimidamide is sourced from PubChem (CID 106711855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).