C11H21F3N2O2 — CID 106711867
N'-hydroxy-2,2-dimethyl-6-(1,1,1-trifluoropropan-2-yloxy)hexanimidamide (PubChem CID 106711867) has the molecular formula C11H21F3N2O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is N'-hydroxy-2,2-dimethyl-6-(1,1,1-trifluoropropan-2-yloxy)hexanimidamide.
| Compound Name | N'-hydroxy-2,2-dimethyl-6-(1,1,1-trifluoropropan-2-yloxy)hexanimidamide |
|---|---|
| PubChem CID | 106711867 |
| Molecular Formula | C11H21F3N2O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | N'-hydroxy-2,2-dimethyl-6-(1,1,1-trifluoropropan-2-yloxy)hexanimidamide |
| SMILES | CC(OCCCCC(C)(C)C(N)=NO)C(F)(F)F |
| InChI | InChI=1S/C11H21F3N2O2/c1-8(11(12,13)14)18-7-5-4-6-10(2,3)9(15)16-17/h8,17H,4-7H2,1-3H3,(H2,15,16) |
| InChIKey | VBNDOYLUCISNRX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|