C11H18F6N2O2 — CID 106711892
6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N'-hydroxy-2,2-dimethylhexanimidamide (PubChem CID 106711892) has the molecular formula C11H18F6N2O2 and a molecular weight of 324.27 g/mol. Its IUPAC name is 6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N'-hydroxy-2,2-dimethylhexanimidamide.
| Compound Name | 6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N'-hydroxy-2,2-dimethylhexanimidamide |
|---|---|
| PubChem CID | 106711892 |
| Molecular Formula | C11H18F6N2O2 |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N'-hydroxy-2,2-dimethylhexanimidamide |
| SMILES | CC(C)(CCCCOC(C(F)(F)F)C(F)(F)F)C(N)=NO |
| InChI | InChI=1S/C11H18F6N2O2/c1-9(2,8(18)19-20)5-3-4-6-21-7(10(12,13)14)11(15,16)17/h7,20H,3-6H2,1-2H3,(H2,18,19) |
| InChIKey | XXCCIVKMNVOWIP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|