C18H29N3 — CID 106711911
2,2-dimethyl-6-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)hexanimidamide (PubChem CID 106711911) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is 2,2-dimethyl-6-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)hexanimidamide.
| Compound Name | 2,2-dimethyl-6-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)hexanimidamide |
|---|---|
| PubChem CID | 106711911 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | 2,2-dimethyl-6-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)hexanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCCCN1c2ccccc2CCC1C |
| InChI | InChI=1S/C18H29N3/c1-14-10-11-15-8-4-5-9-16(15)21(14)13-7-6-12-18(2,3)17(19)20/h4-5,8-9,14H,6-7,10-13H2,1-3H3,(H3,19,20) |
| InChIKey | SBQPNPBDCQVBMN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|