C11H20F4N2O — CID 106712373
2,2-dimethyl-6-(2,2,3,3-tetrafluoropropoxy)hexanimidamide (PubChem CID 106712373) has the molecular formula C11H20F4N2O and a molecular weight of 272.29 g/mol. Its IUPAC name is 2,2-dimethyl-6-(2,2,3,3-tetrafluoropropoxy)hexanimidamide.
| Compound Name | 2,2-dimethyl-6-(2,2,3,3-tetrafluoropropoxy)hexanimidamide |
|---|---|
| PubChem CID | 106712373 |
| Molecular Formula | C11H20F4N2O |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 2,2-dimethyl-6-(2,2,3,3-tetrafluoropropoxy)hexanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCCCOCC(F)(F)C(F)F |
| InChI | InChI=1S/C11H20F4N2O/c1-10(2,9(16)17)5-3-4-6-18-7-11(14,15)8(12)13/h8H,3-7H2,1-2H3,(H3,16,17) |
| InChIKey | TWWWHVLLGBIULW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|