C11H21F3N2O — CID 106712459
2,2-dimethyl-6-(1,1,1-trifluoropropan-2-yloxy)hexanimidamide (PubChem CID 106712459) has the molecular formula C11H21F3N2O and a molecular weight of 254.30 g/mol. Its IUPAC name is 2,2-dimethyl-6-(1,1,1-trifluoropropan-2-yloxy)hexanimidamide.
| Compound Name | 2,2-dimethyl-6-(1,1,1-trifluoropropan-2-yloxy)hexanimidamide |
|---|---|
| PubChem CID | 106712459 |
| Molecular Formula | C11H21F3N2O |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 2,2-dimethyl-6-(1,1,1-trifluoropropan-2-yloxy)hexanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCCCOC(C)C(F)(F)F |
| InChI | InChI=1S/C11H21F3N2O/c1-8(11(12,13)14)17-7-5-4-6-10(2,3)9(15)16/h8H,4-7H2,1-3H3,(H3,15,16) |
| InChIKey | DMVZXCMFTROQPF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|