C16H26N2OS — CID 106712686
6-(2,4-dimethylphenyl)sulfanyl-N'-hydroxy-2,2-dimethylhexanimidamide (PubChem CID 106712686) has the molecular formula C16H26N2OS and a molecular weight of 294.46 g/mol. Its IUPAC name is 6-(2,4-dimethylphenyl)sulfanyl-N'-hydroxy-2,2-dimethylhexanimidamide.
| Compound Name | 6-(2,4-dimethylphenyl)sulfanyl-N'-hydroxy-2,2-dimethylhexanimidamide |
|---|---|
| PubChem CID | 106712686 |
| Molecular Formula | C16H26N2OS |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 6-(2,4-dimethylphenyl)sulfanyl-N'-hydroxy-2,2-dimethylhexanimidamide |
| SMILES | Cc1ccc(SCCCCC(C)(C)/C(N)=N/O)c(C)c1 |
| InChI | InChI=1S/C16H26N2OS/c1-12-7-8-14(13(2)11-12)20-10-6-5-9-16(3,4)15(17)18-19/h7-8,11,19H,5-6,9-10H2,1-4H3,(H2,17,18) |
| InChIKey | BPUMBFKVHOAKJB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|