C12H21N3OS2 — CID 106712696
N'-hydroxy-2,2-dimethyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]hexanimidamide (PubChem CID 106712696) has the molecular formula C12H21N3OS2 and a molecular weight of 287.45 g/mol. Its IUPAC name is N'-hydroxy-2,2-dimethyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]hexanimidamide.
| Compound Name | N'-hydroxy-2,2-dimethyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]hexanimidamide |
|---|---|
| PubChem CID | 106712696 |
| Molecular Formula | C12H21N3OS2 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | N'-hydroxy-2,2-dimethyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]hexanimidamide |
| SMILES | Cc1csc(SCCCCC(C)(C)C(N)=NO)n1 |
| InChI | InChI=1S/C12H21N3OS2/c1-9-8-18-11(14-9)17-7-5-4-6-12(2,3)10(13)15-16/h8,16H,4-7H2,1-3H3,(H2,13,15) |
| InChIKey | URHDXDMCXJHAQS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|