C11H20N4O2S — CID 106712726
N'-hydroxy-2,2-dimethyl-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]hexanimidamide (PubChem CID 106712726) has the molecular formula C11H20N4O2S and a molecular weight of 272.37 g/mol. Its IUPAC name is N'-hydroxy-2,2-dimethyl-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]hexanimidamide.
| Compound Name | N'-hydroxy-2,2-dimethyl-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]hexanimidamide |
|---|---|
| PubChem CID | 106712726 |
| Molecular Formula | C11H20N4O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N'-hydroxy-2,2-dimethyl-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]hexanimidamide |
| SMILES | Cc1nnc(SCCCCC(C)(C)C(N)=NO)o1 |
| InChI | InChI=1S/C11H20N4O2S/c1-8-13-14-10(17-8)18-7-5-4-6-11(2,3)9(12)15-16/h16H,4-7H2,1-3H3,(H2,12,15) |
| InChIKey | GFRCFZDXUQBMPH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 97.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|