About N-[3-(4-chlorophenyl)-1,5-diphenyl-1,2,4-triazol-1-ium-4-yl]benzamide
N-[3-(4-chlorophenyl)-1,5-diphenyl-1,2,4-triazol-1-ium-4-yl]benzamide (PubChem CID 10671291) has the molecular formula C27H20ClN4O+
and a molecular weight of 451.94 g/mol. Its IUPAC name is N-[3-(4-chlorophenyl)-1,5-diphenyl-1,2,4-triazol-1-ium-4-yl]benzamide.
Molecular Properties
| Compound Name | N-[3-(4-chlorophenyl)-1,5-diphenyl-1,2,4-triazol-1-ium-4-yl]benzamide |
| PubChem CID | 10671291 |
| Molecular Formula | C27H20ClN4O+ |
| Molecular Weight | 451.94 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | N-[3-(4-chlorophenyl)-1,5-diphenyl-1,2,4-triazol-1-ium-4-yl]benzamide |
| SMILES | O=C(Nn1c(-c2ccc(Cl)cc2)n[n+](-c2ccccc2)c1-c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H19ClN4O/c28-23-18-16-20(17-19-23)25-29-31(24-14-8-3-9-15-24)27(22-12-6-2-7-13-22)32(25)30-26(33)21-10-4-1-5-11-21/h1-19H/p+1 |
| InChIKey | FTKXCKIWVFEJTH-UHFFFAOYSA-O |
| XLogP | 5.53 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.94 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(4-chlorophenyl)-1,5-diphenyl-1,2,4-triazol-1-ium-4-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(4-chlorophenyl)-1,5-diphenyl-1,2,4-triazol-1-ium-4-yl]benzamide?
The IUPAC name of N-[3-(4-chlorophenyl)-1,5-diphenyl-1,2,4-triazol-1-ium-4-yl]benzamide (CID 10671291) is N-[3-(4-chlorophenyl)-1,5-diphenyl-1,2,4-triazol-1-ium-4-yl]benzamide.
What is the SMILES notation for N-[3-(4-chlorophenyl)-1,5-diphenyl-1,2,4-triazol-1-ium-4-yl]benzamide?
The canonical SMILES for N-[3-(4-chlorophenyl)-1,5-diphenyl-1,2,4-triazol-1-ium-4-yl]benzamide is O=C(Nn1c(-c2ccc(Cl)cc2)n[n+](-c2ccccc2)c1-c1ccccc1)c1ccccc1.
What is the InChIKey of N-[3-(4-chlorophenyl)-1,5-diphenyl-1,2,4-triazol-1-ium-4-yl]benzamide?
The InChIKey is FTKXCKIWVFEJTH-UHFFFAOYSA-O. The full InChI is InChI=1S/C27H19ClN4O/c28-23-18-16-20(17-19-23)25-29-31(24-14-8-3-9-15-24)27(22-12-6-2-7-13-22)32(25)30-26(33)21-10-4-1-5-11-21/h1-19H/p+1.
What are the key properties of N-[3-(4-chlorophenyl)-1,5-diphenyl-1,2,4-triazol-1-ium-4-yl]benzamide?
N-[3-(4-chlorophenyl)-1,5-diphenyl-1,2,4-triazol-1-ium-4-yl]benzamide has a molecular weight of 451.94 g/mol, XLogP of 5.53, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(4-chlorophenyl)-1,5-diphenyl-1,2,4-triazol-1-ium-4-yl]benzamide is sourced from PubChem (CID 10671291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).