C15H24N2O2 — CID 106713922
2,2-dimethyl-6-[methyl(pyridin-4-ylmethyl)amino]hexanoic acid (PubChem CID 106713922) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 2,2-dimethyl-6-[methyl(pyridin-4-ylmethyl)amino]hexanoic acid.
| Compound Name | 2,2-dimethyl-6-[methyl(pyridin-4-ylmethyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 106713922 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 2,2-dimethyl-6-[methyl(pyridin-4-ylmethyl)amino]hexanoic acid |
| SMILES | CN(CCCCC(C)(C)C(=O)O)Cc1ccncc1 |
| InChI | InChI=1S/C15H24N2O2/c1-15(2,14(18)19)8-4-5-11-17(3)12-13-6-9-16-10-7-13/h6-7,9-10H,4-5,8,11-12H2,1-3H3,(H,18,19) |
| InChIKey | KVBPHKIXKKTSJP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|