C14H22N2O4 — CID 106714186
6-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)-2,2-dimethylhexanoic acid (PubChem CID 106714186) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is 6-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)-2,2-dimethylhexanoic acid.
| Compound Name | 6-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)-2,2-dimethylhexanoic acid |
|---|---|
| PubChem CID | 106714186 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 6-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)-2,2-dimethylhexanoic acid |
| SMILES | Cc1c(C)c(=O)n(CCCCC(C)(C)C(=O)O)[nH]c1=O |
| InChI | InChI=1S/C14H22N2O4/c1-9-10(2)12(18)16(15-11(9)17)8-6-5-7-14(3,4)13(19)20/h5-8H2,1-4H3,(H,15,17)(H,19,20) |
| InChIKey | QSMRHBHAZGACJA-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|