C14H23N3O3 — CID 106714216
6-[4-(dimethylamino)-6-oxopyridazin-1-yl]-2,2-dimethylhexanoic acid (PubChem CID 106714216) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 6-[4-(dimethylamino)-6-oxopyridazin-1-yl]-2,2-dimethylhexanoic acid.
| Compound Name | 6-[4-(dimethylamino)-6-oxopyridazin-1-yl]-2,2-dimethylhexanoic acid |
|---|---|
| PubChem CID | 106714216 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 6-[4-(dimethylamino)-6-oxopyridazin-1-yl]-2,2-dimethylhexanoic acid |
| SMILES | CN(C)c1cnn(CCCCC(C)(C)C(=O)O)c(=O)c1 |
| InChI | InChI=1S/C14H23N3O3/c1-14(2,13(19)20)7-5-6-8-17-12(18)9-11(10-15-17)16(3)4/h9-10H,5-8H2,1-4H3,(H,19,20) |
| InChIKey | FSOINYOHVVCAFN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|