C17H22N2 — CID 106714540
2,2-dimethyl-6-(2-methylindol-1-yl)hexanenitrile (PubChem CID 106714540) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 2,2-dimethyl-6-(2-methylindol-1-yl)hexanenitrile.
| Compound Name | 2,2-dimethyl-6-(2-methylindol-1-yl)hexanenitrile |
|---|---|
| PubChem CID | 106714540 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 2,2-dimethyl-6-(2-methylindol-1-yl)hexanenitrile |
| SMILES | Cc1cc2ccccc2n1CCCCC(C)(C)C#N |
| InChI | InChI=1S/C17H22N2/c1-14-12-15-8-4-5-9-16(15)19(14)11-7-6-10-17(2,3)13-18/h4-5,8-9,12H,6-7,10-11H2,1-3H3 |
| InChIKey | BIIPJDRQELMIHW-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|