About 7-[2-ethyl-4-(4-methylphenyl)-5-phenylmethoxyphenoxy]-2,2-dimethylheptanenitrile
7-[2-ethyl-4-(4-methylphenyl)-5-phenylmethoxyphenoxy]-2,2-dimethylheptanenitrile (PubChem CID 10671469) has the molecular formula C31H37NO2
and a molecular weight of 455.64 g/mol. Its IUPAC name is 7-[2-ethyl-4-(4-methylphenyl)-5-phenylmethoxyphenoxy]-2,2-dimethylheptanenitrile.
Molecular Properties
| Compound Name | 7-[2-ethyl-4-(4-methylphenyl)-5-phenylmethoxyphenoxy]-2,2-dimethylheptanenitrile |
| PubChem CID | 10671469 |
| Molecular Formula | C31H37NO2 |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | 7-[2-ethyl-4-(4-methylphenyl)-5-phenylmethoxyphenoxy]-2,2-dimethylheptanenitrile |
| SMILES | CCc1cc(-c2ccc(C)cc2)c(OCc2ccccc2)cc1OCCCCCC(C)(C)C#N |
| InChI | InChI=1S/C31H37NO2/c1-5-26-20-28(27-16-14-24(2)15-17-27)30(34-22-25-12-8-6-9-13-25)21-29(26)33-19-11-7-10-18-31(3,4)23-32/h6,8-9,12-17,20-21H,5,7,10-11,18-19,22H2,1-4H3 |
| InChIKey | HTBZCKHKMIHAOO-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-[2-ethyl-4-(4-methylphenyl)-5-phenylmethoxyphenoxy]-2,2-dimethylheptanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[2-ethyl-4-(4-methylphenyl)-5-phenylmethoxyphenoxy]-2,2-dimethylheptanenitrile?
The IUPAC name of 7-[2-ethyl-4-(4-methylphenyl)-5-phenylmethoxyphenoxy]-2,2-dimethylheptanenitrile (CID 10671469) is 7-[2-ethyl-4-(4-methylphenyl)-5-phenylmethoxyphenoxy]-2,2-dimethylheptanenitrile.
What is the SMILES notation for 7-[2-ethyl-4-(4-methylphenyl)-5-phenylmethoxyphenoxy]-2,2-dimethylheptanenitrile?
The canonical SMILES for 7-[2-ethyl-4-(4-methylphenyl)-5-phenylmethoxyphenoxy]-2,2-dimethylheptanenitrile is CCc1cc(-c2ccc(C)cc2)c(OCc2ccccc2)cc1OCCCCCC(C)(C)C#N.
What is the InChIKey of 7-[2-ethyl-4-(4-methylphenyl)-5-phenylmethoxyphenoxy]-2,2-dimethylheptanenitrile?
The InChIKey is HTBZCKHKMIHAOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H37NO2/c1-5-26-20-28(27-16-14-24(2)15-17-27)30(34-22-25-12-8-6-9-13-25)21-29(26)33-19-11-7-10-18-31(3,4)23-32/h6,8-9,12-17,20-21H,5,7,10-11,18-19,22H2,1-4H3.
What are the key properties of 7-[2-ethyl-4-(4-methylphenyl)-5-phenylmethoxyphenoxy]-2,2-dimethylheptanenitrile?
7-[2-ethyl-4-(4-methylphenyl)-5-phenylmethoxyphenoxy]-2,2-dimethylheptanenitrile has a molecular weight of 455.64 g/mol, XLogP of 8.29, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[2-ethyl-4-(4-methylphenyl)-5-phenylmethoxyphenoxy]-2,2-dimethylheptanenitrile is sourced from PubChem (CID 10671469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).