C23H22N3O+ — CID 10671475
methyl(3-oxa-14,21-diazahexacyclo[15.7.1.02,15.04,13.07,12.021,25]pentacosa-1(25),2(15),4,7,9,11,13,16-octaen-6-ylidene)azanium (PubChem CID 10671475) has the molecular formula C23H22N3O+ and a molecular weight of 356.45 g/mol. Its IUPAC name is methyl(3-oxa-14,21-diazahexacyclo[15.7.1.02,15.04,13.07,12.021,25]pentacosa-1(25),2(15),4,7,9,11,13,16-octaen-6-ylidene)azanium.
| Compound Name | methyl(3-oxa-14,21-diazahexacyclo[15.7.1.02,15.04,13.07,12.021,25]pentacosa-1(25),2(15),4,7,9,11,13,16-octaen-6-ylidene)azanium |
|---|---|
| PubChem CID | 10671475 |
| Molecular Formula | C23H22N3O+ |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | methyl(3-oxa-14,21-diazahexacyclo[15.7.1.02,15.04,13.07,12.021,25]pentacosa-1(25),2(15),4,7,9,11,13,16-octaen-6-ylidene)azanium |
| SMILES | C/[NH+]=c1\cc2oc3c4c5c(cc3nc-2c2ccccc12)CCCN5CCC4 |
| InChI | InChI=1S/C23H21N3O/c1-24-18-13-20-21(16-8-3-2-7-15(16)18)25-19-12-14-6-4-10-26-11-5-9-17(22(14)26)23(19)27-20/h2-3,7-8,12-13H,4-6,9-11H2,1H3/p+1/b24-18+ |
| InChIKey | ADPCWGPKTSQLQY-HKOYGPOVSA-O |
| XLogP | 2.40 |
| TPSA | 43.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|