C13H18ClN5O7S2 — CID 10671476
N-(3-methyl-5-sulfamoyl-1,3,4-thiadiazol-2-ylidene)-2-(2,4,6-trimethylpyridin-1-ium-1-yl)acetamide perchlorate (PubChem CID 10671476) has the molecular formula C13H18ClN5O7S2 and a molecular weight of 455.90 g/mol. Its IUPAC name is N-(3-methyl-5-sulfamoyl-1,3,4-thiadiazol-2-ylidene)-2-(2,4,6-trimethylpyridin-1-ium-1-yl)acetamide perchlorate.
| Compound Name | N-(3-methyl-5-sulfamoyl-1,3,4-thiadiazol-2-ylidene)-2-(2,4,6-trimethylpyridin-1-ium-1-yl)acetamide perchlorate |
|---|---|
| PubChem CID | 10671476 |
| Molecular Formula | C13H18ClN5O7S2 |
| Molecular Weight | 455.90 g/mol |
| Exact Mass | 455.03 |
| IUPAC Name | N-(3-methyl-5-sulfamoyl-1,3,4-thiadiazol-2-ylidene)-2-(2,4,6-trimethylpyridin-1-ium-1-yl)acetamide perchlorate |
| SMILES | Cc1cc(C)[n+](CC(=O)/N=c2\sc(S(N)(=O)=O)nn2C)c(C)c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C13H18N5O3S2.ClHO4/c1-8-5-9(2)18(10(3)6-8)7-11(19)15-12-17(4)16-13(22-12)23(14,20)21;2-1(3,4)5/h5-6H,7H2,1-4H3,(H2,14,20,21);(H,2,3,4,5)/q+1;/p-1/b15-12-; |
| InChIKey | OEOGQTJBOJMWOF-OBBOLZQKSA-M |
| XLogP | -5.29 |
| TPSA | 203.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.90 |
| LogP ≤ 5 | -5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|