C12H27NOS — CID 106714791
6-tert-butylsulfinyl-2,2-dimethylhexan-1-amine (PubChem CID 106714791) has the molecular formula C12H27NOS and a molecular weight of 233.42 g/mol. Its IUPAC name is 6-tert-butylsulfinyl-2,2-dimethylhexan-1-amine.
| Compound Name | 6-tert-butylsulfinyl-2,2-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 106714791 |
| Molecular Formula | C12H27NOS |
| Molecular Weight | 233.42 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 6-tert-butylsulfinyl-2,2-dimethylhexan-1-amine |
| SMILES | CC(C)(CN)CCCCS(=O)C(C)(C)C |
| InChI | InChI=1S/C12H27NOS/c1-11(2,3)15(14)9-7-6-8-12(4,5)10-13/h6-10,13H2,1-5H3 |
| InChIKey | SKPZOYQGZWFEKW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|