About 6-[(3,5-dimethylphenyl)methylsulfinyl]-2,2-dimethylhexan-1-amine
6-[(3,5-dimethylphenyl)methylsulfinyl]-2,2-dimethylhexan-1-amine (PubChem CID 106714818) has the molecular formula C17H29NOS
and a molecular weight of 295.49 g/mol. Its IUPAC name is 6-[(3,5-dimethylphenyl)methylsulfinyl]-2,2-dimethylhexan-1-amine.
Molecular Properties
| Compound Name | 6-[(3,5-dimethylphenyl)methylsulfinyl]-2,2-dimethylhexan-1-amine |
| PubChem CID | 106714818 |
| Molecular Formula | C17H29NOS |
| Molecular Weight | 295.49 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | 6-[(3,5-dimethylphenyl)methylsulfinyl]-2,2-dimethylhexan-1-amine |
| SMILES | Cc1cc(C)cc(CS(=O)CCCCC(C)(C)CN)c1 |
| InChI | InChI=1S/C17H29NOS/c1-14-9-15(2)11-16(10-14)12-20(19)8-6-5-7-17(3,4)13-18/h9-11H,5-8,12-13,18H2,1-4H3 |
| InChIKey | FEPBBDLZXDFKCV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[(3,5-dimethylphenyl)methylsulfinyl]-2,2-dimethylhexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3,5-dimethylphenyl)methylsulfinyl]-2,2-dimethylhexan-1-amine?
The IUPAC name of 6-[(3,5-dimethylphenyl)methylsulfinyl]-2,2-dimethylhexan-1-amine (CID 106714818) is 6-[(3,5-dimethylphenyl)methylsulfinyl]-2,2-dimethylhexan-1-amine.
What is the SMILES notation for 6-[(3,5-dimethylphenyl)methylsulfinyl]-2,2-dimethylhexan-1-amine?
The canonical SMILES for 6-[(3,5-dimethylphenyl)methylsulfinyl]-2,2-dimethylhexan-1-amine is Cc1cc(C)cc(CS(=O)CCCCC(C)(C)CN)c1.
What is the InChIKey of 6-[(3,5-dimethylphenyl)methylsulfinyl]-2,2-dimethylhexan-1-amine?
The InChIKey is FEPBBDLZXDFKCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29NOS/c1-14-9-15(2)11-16(10-14)12-20(19)8-6-5-7-17(3,4)13-18/h9-11H,5-8,12-13,18H2,1-4H3.
What are the key properties of 6-[(3,5-dimethylphenyl)methylsulfinyl]-2,2-dimethylhexan-1-amine?
6-[(3,5-dimethylphenyl)methylsulfinyl]-2,2-dimethylhexan-1-amine has a molecular weight of 295.49 g/mol, XLogP of 3.71, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3,5-dimethylphenyl)methylsulfinyl]-2,2-dimethylhexan-1-amine is sourced from PubChem (CID 106714818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).