C15H24N4O — CID 106714923
2,2-dimethyl-6-[6-oxo-4-(propylamino)pyridazin-1-yl]hexanenitrile (PubChem CID 106714923) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is 2,2-dimethyl-6-[6-oxo-4-(propylamino)pyridazin-1-yl]hexanenitrile.
| Compound Name | 2,2-dimethyl-6-[6-oxo-4-(propylamino)pyridazin-1-yl]hexanenitrile |
|---|---|
| PubChem CID | 106714923 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 2,2-dimethyl-6-[6-oxo-4-(propylamino)pyridazin-1-yl]hexanenitrile |
| SMILES | CCCNc1cnn(CCCCC(C)(C)C#N)c(=O)c1 |
| InChI | InChI=1S/C15H24N4O/c1-4-8-17-13-10-14(20)19(18-11-13)9-6-5-7-15(2,3)12-16/h10-11,17H,4-9H2,1-3H3 |
| InChIKey | BNRVNTPYWNARAO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|